Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A279 | Purity: >98% |
 | |
| Chemical structure of ICILIN |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | AG-3-5 |
|---|---|
| CAS No. | 36945-98-9 |
| Purity | >98% |
| Formula | C16H13N3O4 |
| Mol Weight | 311.2921 |
| CoA | CoA of ICILIN |
| Smiles: | OC1=CC=CC=C1N1CC=C(NC1=O)C1=CC=CC(=C1)[N+]([O-])=O |
|---|
KEYWORDS: buy ICILIN | ICILIN supplier | purchase | cost | manufacturer | order | distributor | buy 36945-98-9 | 36945-98-9 supplier