Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A4991 | Purity: >98% |
 | |
| Chemical structure of ICA-105574 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 316146-57-3 |
|---|---|
| Purity | >98% |
| Formula | C19H14N2O4 |
| Mol Weight | 334.3255 |
| CoA | CoA of ICA-105574 |
| Smiles: | C1=CC=C(C=C1)OC2=CC=C(C=C2)NC(=O)C3=CC(=CC=C3)[N+](=O)[O-] |
|---|
KEYWORDS: buy ICA-105574 | ICA-105574 supplier | purchase | cost | manufacturer | order | distributor | buy 316146-57-3 | 316146-57-3 supplier