Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A326 | Purity: >98% |
 | |
| Chemical structure of IC-87114 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 371242-69-2 |
|---|---|
| Purity | >98% |
| Formula | C22H19N7O |
| Mol Weight | 397.4326 |
| CoA | CoA of IC-87114 |
| Smiles: | CC1=CC=CC=C1N1C(=O)C2=C(C=CC=C2C)N=C1CN1C=NC2=C(N)N=CN=C12 |
|---|
KEYWORDS: buy IC-87114 | IC-87114 supplier | purchase | cost | manufacturer | order | distributor | buy 371242-69-2 | 371242-69-2 supplier