Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A12863 | Purity: >98% |
 | |
| Chemical structure of hydrogenobyrinic acid |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 23599-55-5 |
|---|---|
| Purity | >98% |
| Formula | C45H60N4O14 |
| Mol Weight | 880.9763 |
| CoA | CoA of hydrogenobyrinic acid |
| Smiles: | O=C(O)CCC1C2=NC(=C(C3=NC(C)(C4NC(=C(C5=NC(=C2)C(C)(C)C5CCC(=O)O)C)C(C)(CCC(=O)O)C4CC(=O)O)C(C)(CC(=O)O)C3CCC(=O)O)C)C1(C)CC(=O)O |
|---|
KEYWORDS: buy hydrogenobyrinic acid | hydrogenobyrinic acid supplier | purchase | cost | manufacturer | order | distributor | buy 23599-55-5 | 23599-55-5 supplier