Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A13507 | Purity: >98% |
 | |
| Chemical structure of HSGN-144 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2519410-01-4 |
|---|---|
| Purity | >98% |
| Formula | C13H8F5N3O2S2 |
| Mol Weight | 397.344 |
| CoA | CoA of HSGN-144 |
| Smiles: | O=C(NC1=NN=C(O1)C=2SC=CC2)C3=CC=C(C=C3)S(F)(F)(F)(F)F |
|---|
KEYWORDS: buy HSGN-144 | HSGN-144 supplier | purchase | cost | manufacturer | order | distributor | buy 2519410-01-4 | 2519410-01-4 supplier