Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A349 | Purity: >98% |
 | |
| Chemical structure of HPGDS-inhibitor-1 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1033836-12-2 |
|---|---|
| Purity | >98% |
| Formula | C19H19F4N3O |
| Mol Weight | 381.3673 |
| CoA | CoA of HPGDS-inhibitor-1 |
| Smiles: | FC1=CC=CC(=C1)C1=CC=C(C=N1)C(=O)NC1CCN(CC(F)(F)F)CC1 |
|---|
KEYWORDS: buy HPGDS-inhibitor-1 | HPGDS-inhibitor-1 supplier | purchase | cost | manufacturer | order | distributor | buy 1033836-12-2 | 1033836-12-2 supplier