Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1869 | Purity: >98% |
 | |
| Chemical structure of HLCL-61hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1158279-20-9 |
|---|---|
| Purity | >98% |
| Formula | C23H25ClN2O |
| Mol Weight | 380.91 |
| CoA | CoA of HLCL-61hydrochloride |
| Smiles: | Cl[H].CCN1C2=C(C=CC=C2)C2=C1C=CC(CNCC1=CC=CC=C1OC)=C2 |
|---|
KEYWORDS: buy HLCL-61hydrochloride | HLCL-61hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 1158279-20-9 | 1158279-20-9 supplier