Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2899 | Purity: >98% |
 | |
| Chemical structure of HJC0152 hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1420290-99-8 |
|---|---|
| Purity | >98% |
| Formula | C15H14Cl3N3O4 |
| Mol Weight | 406.648 |
| CoA | CoA of HJC0152 hydrochloride |
| Smiles: | Cl[H].NCCOC1=CC=C(Cl)C=C1C(=O)NC1=CC=C(C=C1Cl)[N+]([O-])=O |
|---|
KEYWORDS: buy HJC0152 hydrochloride | HJC0152 hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 1420290-99-8 | 1420290-99-8 supplier