Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2068 | Purity: >98% |
 | |
| Chemical structure of HJC-0350 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 885434-70-8 |
|---|---|
| Purity | >98% |
| Formula | C15H19NO2S |
| Mol Weight | 277.382 |
| CoA | CoA of HJC-0350 |
| Smiles: | CC1=CN(C(C)=C1)S(=O)(=O)C1=C(C)C=C(C)C=C1C |
|---|
KEYWORDS: buy HJC-0350 | HJC-0350 supplier | purchase | cost | manufacturer | order | distributor | buy 885434-70-8 | 885434-70-8 supplier