Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A15595 | Purity: >98% |
 | |
| Chemical structure of HBTM-2.1 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1203507-02-1 |
|---|---|
| Purity | >98% |
| Formula | C19H20N2S |
| Mol Weight | 308.441 |
| CoA | CoA of HBTM-2.1 |
| Smiles: | CC(C)[C@@H]1CN2C3=CC=CC=C3SC2=N[C@@H]1C4=CC=CC=C4 |
|---|
KEYWORDS: buy HBTM-2.1 | HBTM-2.1 supplier | purchase | cost | manufacturer | order | distributor | buy 1203507-02-1 | 1203507-02-1 supplier