Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A9733 | Purity: >98% |
 | |
| Chemical structure of HBED-CC-FAPI |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 3023839-06-4 |
|---|---|
| Purity | >98% |
| Formula | C50H58F2N8O12 |
| Mol Weight | 1001.0387 |
| CoA | CoA of HBED-CC-FAPI |
| Smiles: | C(NCC(=O)N1[C@H](C#N)CC(F)(F)C1)(=O)C=2C3=C(C=CC(OCCCN4CCN(C(CCC5=CC(CN(CCN(CC6=CC(CCC(O)=O)=CC=C6O)CC(O)=O)CC(O)=O)=C(O)C=C5)=O)CC4)=C3)N=CC2 |
|---|
KEYWORDS: buy HBED-CC-FAPI | HBED-CC-FAPI supplier | purchase | cost | manufacturer | order | distributor | buy 3023839-06-4 | 3023839-06-4 supplier