Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A11508 | Purity: >98% |
 | |
| Chemical structure of Halosulfuron |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 135397-30-7 |
|---|---|
| Purity | >98% |
| Formula | C12H13ClN6O7S |
| Mol Weight | 420.786 |
| CoA | CoA of Halosulfuron |
| Smiles: | O=C(O)C=1C(Cl)=NN(C1S(=O)(=O)NC(=O)NC=2N=C(OC)C=C(N2)OC)C |
|---|
KEYWORDS: buy Halosulfuron | Halosulfuron supplier | purchase | cost | manufacturer | order | distributor | buy 135397-30-7 | 135397-30-7 supplier