Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2942 | Purity: >98% |
 | |
| Chemical structure of H3B-6545 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2052130-80-8 |
|---|---|
| Purity | >98% |
| Formula | C30H29F4N5O2 |
| Mol Weight | 567.5772 |
| CoA | CoA of H3B-6545 |
| Smiles: | CN(C)C(=O)\C=C\CNCCOC1=NC=C(C=C1)C(=C(\CC(F)(F)F)C1=CC=CC=C1)\C1=CC2=C(NN=C2F)C=C1 |
|---|
KEYWORDS: buy H3B-6545 | H3B-6545 supplier | purchase | cost | manufacturer | order | distributor | buy 2052130-80-8 | 2052130-80-8 supplier