Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1365 | Purity: >98% |
 | |
| Chemical structure of GZD824 Dimesylate |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1421783-64-3 |
|---|---|
| Purity | >98% |
| Formula | C31H35F3N6O7S2 |
| Mol Weight | 724.771 |
| CoA | CoA of GZD824 Dimesylate |
| Smiles: | CS(O)(=O)=O.CS(O)(=O)=O.CN1CCN(CC2=CC=C(NC(=O)C3=CC=C(C)C(=C3)C#CC3=CN=C4NN=CC4=C3)C=C2C(F)(F)F)CC1 |
|---|
KEYWORDS: buy GZD824 Dimesylate | GZD824 Dimesylate supplier | purchase | cost | manufacturer | order | distributor | buy 1421783-64-3 | 1421783-64-3 supplier