Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A122 | Purity: >98% |
 | |
| Chemical structure of GW788388 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 452342-67-5 |
|---|---|
| Purity | >98% |
| Formula | C25H23N5O2 |
| Mol Weight | 425.4824 |
| CoA | CoA of GW788388 |
| Smiles: | O=C(NC1CCOCC1)C1=CC=C(C=C1)C1=NC=CC(=C1)C1=CNN=C1C1=NC=CC=C1 |
|---|
KEYWORDS: buy GW788388 | GW788388 supplier | purchase | cost | manufacturer | order | distributor | buy 452342-67-5 | 452342-67-5 supplier