Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1842 | Purity: >98% |
 | |
| Chemical structure of GW441756 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 504433-23-2 |
|---|---|
| Purity | >98% |
| Formula | C17H13N3O |
| Mol Weight | 275.3046 |
| CoA | CoA of GW441756 |
| Smiles: | CN1C=C(\C=C2/C(=O)NC3=CC=CN=C23)C2=C1C=CC=C2 |
|---|
KEYWORDS: buy GW441756 | GW441756 supplier | purchase | cost | manufacturer | order | distributor | buy 504433-23-2 | 504433-23-2 supplier