Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A8133 | Purity: >98% |
 | |
| Chemical structure of GW3965 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 405911-09-3 |
|---|---|
| Purity | >98% |
| Formula | C33H31ClF3NO3 |
| Mol Weight | 582.052 |
| CoA | CoA of GW3965 |
| Smiles: | C1=CC=C(C=C1)C(CN(CCCOC2=CC=CC(=C2)CC(=O)O)CC3=C(C(=CC=C3)C(F)(F)F)Cl)C4=CC=CC=C4.Cl |
|---|
KEYWORDS: buy GW3965 | GW3965 supplier | purchase | cost | manufacturer | order | distributor | buy 405911-09-3 | 405911-09-3 supplier