Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A603 | Purity: >98% |
 | |
| Chemical structure of GW 627368 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 439288-66-1 |
|---|---|
| Purity | >98% |
| Formula | C30H28N2O6S |
| Mol Weight | 544.618 |
| CoA | CoA of GW 627368 |
| Smiles: | CCOC1=C2C=CC=CC2=C(OCC)C2=C1CN(C2=O)C1=CC=C(CC(=O)NS(=O)(=O)C2=CC=CC=C2)C=C1 |
|---|
KEYWORDS: buy GW 627368 | GW 627368 supplier | purchase | cost | manufacturer | order | distributor | buy 439288-66-1 | 439288-66-1 supplier