Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2920 | Purity: >98% |
 | |
| Chemical structure of Guanoclor |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 5001-32-1 |
|---|---|
| Purity | >98% |
| Formula | C9H12Cl2N4O |
| Mol Weight | 263.124 |
| CoA | CoA of Guanoclor |
| Smiles: | N\C(N)=N\NCCOC1=C(Cl)C=CC=C1Cl |
|---|
KEYWORDS: buy Guanoclor | Guanoclor supplier | purchase | cost | manufacturer | order | distributor | buy 5001-32-1 | 5001-32-1 supplier