Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A633 | Purity: >98% |
 | |
| Chemical structure of GSK923295 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1088965-37-0 |
|---|---|
| Purity | >98% |
| Formula | C32H38ClN5O4 |
| Mol Weight | 592.128 |
| CoA | CoA of GSK923295 |
| Smiles: | CC(C)OC1=CC=C(C=C1Cl)C(=O)N[C@H](CNC(=O)CN(C)C)CC1=CC=C(C=C1)C1=CN2C=CC=C([C@H](C)O)C2=N1 |
|---|
KEYWORDS: buy GSK923295 | GSK923295 supplier | purchase | cost | manufacturer | order | distributor | buy 1088965-37-0 | 1088965-37-0 supplier