Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3001 | Purity: >98% |
 | |
| Chemical structure of GSK3179106 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1627856-64-7 |
|---|---|
| Purity | >98% |
| Formula | C22H21F4N3O4 |
| Mol Weight | 467.4135 |
| CoA | CoA of GSK3179106 |
| Smiles: | CCOC1=CC(=O)NC=C1C1=CC=C(CC(=O)NC2=NOC(=C2)C(C)(C)C(F)(F)F)C(F)=C1 |
|---|
KEYWORDS: buy GSK3179106 | GSK3179106 supplier | purchase | cost | manufacturer | order | distributor | buy 1627856-64-7 | 1627856-64-7 supplier