Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1185 | Purity: >98% |
 | |
| Chemical structure of GSK3039294 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1819986-22-5 |
|---|---|
| Purity | >98% |
| Formula | C30H44N2O14 |
| Mol Weight | 656.6754 |
| CoA | CoA of GSK3039294 |
| Smiles: | O=C(OCOC(=O)[C@@H]1CCCN1C(=O)CCCCC(=O)N1CCC[C@H]1C(=O)OCOC(=O)OC1CCOCC1)OC1CCOCC1 |
|---|
KEYWORDS: buy GSK3039294 | GSK3039294 supplier | purchase | cost | manufacturer | order | distributor | buy 1819986-22-5 | 1819986-22-5 supplier