Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1181 | Purity: >98% |
 | |
| Chemical structure of GSK2879552 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1401966-69-5 |
|---|---|
| Purity | >98% |
| Formula | C23H28N2O2 |
| Mol Weight | 364.4806 |
| CoA | CoA of GSK2879552 |
| Smiles: | OC(=O)C1=CC=C(CN2CCC(CN[C@@H]3C[C@H]3C3=CC=CC=C3)CC2)C=C1 |
|---|
KEYWORDS: buy GSK2879552 | GSK2879552 supplier | purchase | cost | manufacturer | order | distributor | buy 1401966-69-5 | 1401966-69-5 supplier