Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1184 | Purity: >98% |
 | |
| Chemical structure of GSK2110183 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1047634-63-8 |
|---|---|
| Purity | >98% |
| Formula | C18H16Cl2F2N4OS |
| Mol Weight | 445.314 |
| CoA | CoA of GSK2110183 |
| Smiles: | CN1N=CC(Cl)=C1C1=C(Cl)SC(=C1)C(=O)N[C@H](CN)CC1=CC=C(F)C(F)=C1 |
|---|
KEYWORDS: buy GSK2110183 | GSK2110183 supplier | purchase | cost | manufacturer | order | distributor | buy 1047634-63-8 | 1047634-63-8 supplier