Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1182 | Purity: >98% |
 | |
| Chemical structure of GSK1940029 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1150701-66-8 |
|---|---|
| Purity | >98% |
| Formula | C18H16Cl2N4O2 |
| Mol Weight | 391.251 |
| CoA | CoA of GSK1940029 |
| Smiles: | CC1=C(N=NN1CC1=CC(Cl)=C(Cl)C=C1)C(=O)NC1=CC=C(CO)C=C1 |
|---|
KEYWORDS: buy GSK1940029 | GSK1940029 supplier | purchase | cost | manufacturer | order | distributor | buy 1150701-66-8 | 1150701-66-8 supplier