Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1743 | Purity: >98% |
 | |
| Chemical structure of GSK126 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | GSK126 |
|---|---|
| CAS No. | 1112980-86-5 |
| Purity | >98% |
| Formula | C20H14ClFN4O3S2 |
| Mol Weight | 476.932 |
| CoA | CoA of GSK126 |
| Smiles: | CC(=O)NC1=NC2=CC=C(C=C2S1)C1=CC(NS(=O)(=O)C2=CC=C(F)C=C2)=C(Cl)N=C1 |
|---|
KEYWORDS: buy GSK126 | GSK126 supplier | purchase | cost | manufacturer | order | distributor | buy 1112980-86-5 | 1112980-86-5 supplier