Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A4550A | Purity: >98% |
 | |
| Chemical structure of GSK114 dihydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | GSK-114 2HCl |
|---|---|
| CAS No. | 1301760-19-9 |
| Purity | >98% |
| Formula | C19H25Cl2N5O4S |
| Mol Weight | 490.404 |
| CoA | CoA of GSK114 dihydrochloride |
| Smiles: | O=S(C1=CC=C(N(C)C)C(NC2=C3C=C(OC)C(OC)=CC3=NC=N2)=C1)(NC)=O |
|---|
KEYWORDS: buy GSK114 dihydrochloride | GSK114 dihydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 1301760-19-9 | 1301760-19-9 supplier