Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A022 | Purity: >98% |
 | |
| Chemical structure of GSK1120212 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Trametinib |
|---|---|
| CAS No. | 871700-17-3 |
| Purity | >98% |
| Formula | C26H23FIN5O4 |
| Mol Weight | 615.3948 |
| CoA | CoA of GSK1120212 |
| Smiles: | CN1C(=O)C(C)=C2N(C(=O)N(C3CC3)C(=O)C2=C1NC1=CC=C(I)C=C1F)C1=CC(NC(C)=O)=CC=C1 |
|---|
KEYWORDS: buy GSK1120212 | GSK1120212 supplier | purchase | cost | manufacturer | order | distributor | buy 871700-17-3 | 871700-17-3 supplier