Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A809 | Purity: >98% |
 | |
| Chemical structure of GSK-J4 hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1373423-53-0 |
|---|---|
| Purity | >98% |
| Formula | C24H28ClN5O2 |
| Mol Weight | 453.964 |
| CoA | CoA of GSK-J4 hydrochloride |
| Smiles: | Cl.CCOC(=O)CCNC1=NC(=NC(=C1)N1CCC2=CC=CC=C2CC1)C1=NC=CC=C1 |
|---|
KEYWORDS: buy GSK-J4 hydrochloride | GSK-J4 hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 1373423-53-0 | 1373423-53-0 supplier