Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3477 | Purity: >98% |
 | |
| Chemical structure of GSK-626616 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1025821-33-3 |
|---|---|
| Purity | >98% |
| Formula | C18H10Cl2N4OS |
| Mol Weight | 401.269 |
| CoA | CoA of GSK-626616 |
| Smiles: | O=C1N=C(NC2=C(Cl)C=CC=C2Cl)S/C1=C\C3=CC=C4N=CC=NC4=C3 |
|---|
KEYWORDS: buy GSK-626616 | GSK-626616 supplier | purchase | cost | manufacturer | order | distributor | buy 1025821-33-3 | 1025821-33-3 supplier