Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1280 | Purity: >98% |
 | |
| Chemical structure of GSK-189254 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 945493-87-8 |
|---|---|
| Purity | >98% |
| Formula | C21H26ClN3O2 |
| Mol Weight | 387.903 |
| CoA | CoA of GSK-189254 |
| Smiles: | Cl[H].CNC(=O)C1=CC=C(OC2=CC=C3CCN(CCC3=C2)C2CCC2)N=C1 |
|---|
KEYWORDS: buy GSK-189254 | GSK-189254 supplier | purchase | cost | manufacturer | order | distributor | buy 945493-87-8 | 945493-87-8 supplier