Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1120 | Purity: >98% |
 | |
| Chemical structure of GS-9973 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Entospletinib |
|---|---|
| CAS No. | 1229208-44-9 |
| Purity | >98% |
| Formula | C23H21N7O |
| Mol Weight | 411.4591 |
| CoA | CoA of GS-9973 |
| Smiles: | C1CN(CCO1)C1=CC=C(NC2=NC(=CN3C=CN=C23)C2=CC3=C(C=NN3)C=C2)C=C1 |
|---|
KEYWORDS: buy GS-9973 | GS-9973 supplier | purchase | cost | manufacturer | order | distributor | buy 1229208-44-9 | 1229208-44-9 supplier