Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A9619 | Purity: >98% |
 | |
| Chemical structure of GS 16141 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Prometrynsulfoxide |
|---|---|
| CAS No. | 55702-48-2 |
| Purity | >98% |
| Formula | C10H19N5OS |
| Mol Weight | 257.356 |
| CoA | CoA of GS 16141 |
| Smiles: | O=S(C=1N=C(N=C(N1)NC(C)C)NC(C)C)C |
|---|
KEYWORDS: buy GS 16141 | GS 16141 supplier | purchase | cost | manufacturer | order | distributor | buy 55702-48-2 | 55702-48-2 supplier