Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2550 | Purity: >98% |
 | |
| Chemical structure of GR148672X |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 263890-70-6 |
|---|---|
| Purity | >98% |
| Formula | C15H11F3N2O2S |
| Mol Weight | 340.32 |
| CoA | CoA of GR148672X |
| Smiles: | CC1=CC(N\N=C(/C(=O)C2=CC=CS2)C(=O)C(F)(F)F)=CC=C1 |
|---|
KEYWORDS: buy GR148672X | GR148672X supplier | purchase | cost | manufacturer | order | distributor | buy 263890-70-6 | 263890-70-6 supplier