Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A594 | Purity: >98% |
 | |
| Chemical structure of GP 2A |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 919077-81-9 |
|---|---|
| Purity | >98% |
| Formula | C24H23Cl2N3O |
| Mol Weight | 440.365 |
| CoA | CoA of GP 2A |
| Smiles: | CC1=CC2=C(C=C1)C1=C(C2)C(=NN1C1=CC=C(Cl)C=C1Cl)C(=O)NC1CCCCC1 |
|---|
KEYWORDS: buy GP 2A | GP 2A supplier | purchase | cost | manufacturer | order | distributor | buy 919077-81-9 | 919077-81-9 supplier