Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1841 | Purity: >98% |
 | |
| Chemical structure of GNE-490 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1033739-92-2 |
|---|---|
| Purity | >98% |
| Formula | C18H22N6O2S |
| Mol Weight | 386.471 |
| CoA | CoA of GNE-490 |
| Smiles: | CC1=NC(N)=NC=C1C1=NC(N2CCOCC2)=C2SC(=CC2=N1)C(C)(C)O |
|---|
KEYWORDS: buy GNE-490 | GNE-490 supplier | purchase | cost | manufacturer | order | distributor | buy 1033739-92-2 | 1033739-92-2 supplier