Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A765 | Purity: >98% |
 | |
| Chemical structure of GM6001 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Galardin |
|---|---|
| Synonyms 2 | Ilomastat |
| CAS No. | 142880-36-2 |
| Purity | >98% |
| Formula | C20H28N4O4 |
| Mol Weight | 388.4607 |
| CoA | CoA of GM6001 |
| Smiles: | CNC(=O)[C@H](CC1=CNC2=C1C=CC=C2)NC(=O)[C@H](CC(C)C)CC(=O)NO |
|---|
KEYWORDS: buy GM6001 | GM6001 supplier | purchase | cost | manufacturer | order | distributor | buy 142880-36-2 | 142880-36-2 supplier