Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2041 | Purity: 0.9897 |
 | |
| Chemical structure of GlyH-101 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 328541-79-3 |
|---|---|
| Purity | 0.9897 |
| Formula | C19H15Br2N3O3 |
| Mol Weight | 493.149 |
| CoA | CoA of GlyH-101 |
| Smiles: | OC1=C(Br)C=C(\C=N\NC(=O)CNC2=CC3=CC=CC=C3C=C2)C(O)=C1Br |
|---|
KEYWORDS: buy GlyH-101 | GlyH-101 supplier | purchase | cost | manufacturer | order | distributor | buy 328541-79-3 | 328541-79-3 supplier