Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2566 | Purity: >98% |
 | |
| Chemical structure of Glesatinib hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | MGCD265 hydrochloride |
|---|---|
| Synonyms 2 | 936694-12-1(free base) |
| CAS No. | 1123838-51-6 |
| Purity | >98% |
| Formula | C31H28ClF2N5O3S2 |
| Mol Weight | 656.166 |
| CoA | CoA of Glesatinib hydrochloride |
| Smiles: | Cl.COCCNCC1=CN=C(C=C1)C1=CC2=NC=CC(OC3=CC=C(NC(=S)NC(=O)CC4=CC=C(F)C=C4)C=C3F)=C2S1 |
|---|
KEYWORDS: buy Glesatinib hydrochloride | Glesatinib hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 1123838-51-6 | 1123838-51-6 supplier