Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1408 | Purity: >98% |
 | |
| Chemical structure of GK921 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1025015-40-0 |
|---|---|
| Purity | >98% |
| Formula | C21H20N4O |
| Mol Weight | 344.4097 |
| CoA | CoA of GK921 |
| Smiles: | C(CN1CCCC1)OC1=NC2=CC=CN=C2N=C1C#CC1=CC=CC=C1 |
|---|
KEYWORDS: buy GK921 | GK921 supplier | purchase | cost | manufacturer | order | distributor | buy 1025015-40-0 | 1025015-40-0 supplier