Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A4990 | Purity: >98% |
 | |
| Chemical structure of GI254023X |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 260264-93-5 |
|---|---|
| Purity | >98% |
| Formula | C21H33N3O4 |
| Mol Weight | 391.5044 |
| CoA | CoA of GI254023X |
| Smiles: | C[C@@H]([C@@H](CCCC1=CC=CC=C1)C(=O)N[C@H](C(=O)NC)C(C)(C)C)N(C=O)O |
|---|
KEYWORDS: buy GI254023X | GI254023X supplier | purchase | cost | manufacturer | order | distributor | buy 260264-93-5 | 260264-93-5 supplier