Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2549 | Purity: >98% |
 | |
| Chemical structure of GGTI298 Trifluoroacetate |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1217457-86-7 |
|---|---|
| Purity | >98% |
| Formula | C29H34F3N3O5S |
| Mol Weight | 593.658 |
| CoA | CoA of GGTI298 Trifluoroacetate |
| Smiles: | OC(=O)C(F)(F)F.COC(=O)[C@H](CC(C)C)NC(=O)C1=CC=C(NC[C@@H](N)CS)C=C1C1=C2C=CC=CC2=CC=C1 |
|---|
KEYWORDS: buy GGTI298 Trifluoroacetate | GGTI298 Trifluoroacetate supplier | purchase | cost | manufacturer | order | distributor | buy 1217457-86-7 | 1217457-86-7 supplier