Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A13542 | Purity: >98% |
 | |
| Chemical structure of GFPGER |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 245120-11-0 |
|---|---|
| Purity | >98% |
| Formula | C29H43N9O9 |
| Mol Weight | 661.7066 |
| CoA | CoA of GFPGER |
| Smiles: | C([C@H](CC1=CC=CC=C1)NC(CN)=O)(=O)N2[C@H](C(NCC(N[C@H](C(N[C@@H](CCCNC(=N)N)C(O)=O)=O)CCC(O)=O)=O)=O)CCC2 |
|---|
KEYWORDS: buy GFPGER | GFPGER supplier | purchase | cost | manufacturer | order | distributor | buy 245120-11-0 | 245120-11-0 supplier