Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2378 | Purity: >98% |
 | |
| Chemical structure of GDC-0810 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Brilanestrant |
|---|---|
| Synonyms 2 | ARN-810 |
| CAS No. | 1365888-06-7 |
| Purity | >98% |
| Formula | C26H20ClFN2O2 |
| Mol Weight | 446.901 |
| CoA | CoA of GDC-0810 |
| Smiles: | CC\C(=C(\C1=CC=C(\C=C\C(O)=O)C=C1)C1=CC2=C(NN=C2)C=C1)C1=CC=C(F)C=C1Cl |
|---|
KEYWORDS: buy GDC-0810 | GDC-0810 supplier | purchase | cost | manufacturer | order | distributor | buy 1365888-06-7 | 1365888-06-7 supplier