Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A7817 | Purity: >98% |
 | |
| Chemical structure of GB-115 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 678996-63-9 |
|---|---|
| Purity | >98% |
| Formula | C25H30N4O3 |
| Mol Weight | 434.5307 |
| CoA | CoA of GB-115 |
| Smiles: | C1=CC=C(C=C1)CCCCCC(=O)NCC(=O)N[C@@H](CC2=CNC3=CC=CC=C32)C(=O)N |
|---|
KEYWORDS: buy GB-115 | GB-115 supplier | purchase | cost | manufacturer | order | distributor | buy 678996-63-9 | 678996-63-9 supplier