Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3488 | Purity: >98% |
 | |
| Chemical structure of Gabazine |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | SR95531 |
|---|---|
| CAS No. | 104104-50-9 |
| Purity | >98% |
| Formula | C15H18BrN3O3 |
| Mol Weight | 368.226 |
| CoA | CoA of Gabazine |
| Smiles: | COC1=CC=C(C=C1)C2=NN(C(=N)C=C2)CCCC(=O)O.Br |
|---|
KEYWORDS: buy Gabazine | Gabazine supplier | purchase | cost | manufacturer | order | distributor | buy 104104-50-9 | 104104-50-9 supplier