Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3642 | Purity: >98% |
 | |
| Chemical structure of G-1 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | 881639-98-1 |
|---|---|
| CAS No. | 881639-98-1 |
| Purity | >98% |
| Formula | C21H18BrNO3 |
| Mol Weight | 412.277 |
| CoA | CoA of G-1 |
| Smiles: | BrC1=C([C@H]2[C@]3([H])[C@](C=CC3)([H])C4=CC(C(C)=O)=CC=C4N2)C=C5C(OCO5)=C1 |
|---|
KEYWORDS: buy G-1 | G-1 supplier | purchase | cost | manufacturer | order | distributor | buy 881639-98-1 | 881639-98-1 supplier