Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2025 | Purity: >98% |
 | |
| Chemical structure of FX1 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1426138-42-2 |
|---|---|
| Purity | >98% |
| Formula | C14H9ClN2O4S2 |
| Mol Weight | 368.815 |
| CoA | CoA of FX1 |
| Smiles: | OC(=O)CCN1C(=S)S\C(C1=O)=C1/C(=O)NC2=C1C=C(Cl)C=C2 |
|---|
KEYWORDS: buy FX1 | FX1 supplier | purchase | cost | manufacturer | order | distributor | buy 1426138-42-2 | 1426138-42-2 supplier