Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2211 | Purity: >98% |
 | |
| Chemical structure of FTI-277 hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 180977-34-8 |
|---|---|
| Purity | >98% |
| Formula | C22H30ClN3O3S2 |
| Mol Weight | 484.075 |
| CoA | CoA of FTI-277 hydrochloride |
| Smiles: | Cl.COC(=O)[C@H](CCSC)NC(=O)C1=CC=C(NC[C@@H](N)CS)C=C1C1=CC=CC=C1 |
|---|
KEYWORDS: buy FTI-277 hydrochloride | FTI-277 hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 180977-34-8 | 180977-34-8 supplier