Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A924 | Purity: >98% |
 | |
| Chemical structure of FPS-ZM1 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 945714-67-0 |
|---|---|
| Purity | >98% |
| Formula | C20H22ClNO |
| Mol Weight | 327.848 |
| CoA | CoA of FPS-ZM1 |
| Smiles: | ClC1=CC=C(C=C1)C(=O)N(CC1=CC=CC=C1)C1CCCCC1 |
|---|
KEYWORDS: buy FPS-ZM1 | FPS-ZM1 supplier | purchase | cost | manufacturer | order | distributor | buy 945714-67-0 | 945714-67-0 supplier